Products 6466-43-9
CAS 6466-43-9 appears in our catalog under these names: TPBM, 98.51%, TPBM, ≥97%, TPBM >= 98 % HPLC, solid. Offered by: MedChemExpress, Chemat, Sigma-Aldrich. Available pack sizes: 100 mg, 50 mg, 10mM/1mL, 25 mg, 5 mg, 10 mg, 1mg, 5mg.
8-(benzylsulfanylmethyl)-1,3-dimethyl-7H-purine-2,6-dione (CAS 6466-43-9) is a chemical compound with the molecular formula C15H16N4O2S and a molecular weight of 316.4 g/mol. IUPAC name: 8-(benzylsulfanylmethyl)-1,3-dimethyl-7H-purine-2,6-dione. InChIKey: FEHAMBYTUPDFJE-UHFFFAOYSA-N.
| Molecular formula | C15H16N4O2S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 8-(benzylsulfanylmethyl)-1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | FEHAMBYTUPDFJE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)CSCC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
TPBM, 8-(benzylsulfanylmethyl)-1,3-dimethyl-7H-purine-2,6-dione, 8-Benzylsulfanylmethyl-1,3-dimethyl-3,7-dihydro-purine-2,6-dione, 8-[(benzylsulfanyl)methyl]-1,3-dimethyl-3,7-dihydro-1h-purine-2,6-dione, NCIStruc1_001567, NCIStruc2_001461, orb1689205, orb3032991, TPBM, >=98% (HPLC), solid, 8-(benzylthiomethyl)-1,6(3H,7H)-dione