CAS 64681-08-9 is the registry number for sn-Glycero-3-phosphocholine 1:1 cadmium chloride adduct. Offered by: MedChemExpress. Available pack sizes: Get quote.
Dichlorocadmium;2,3-dihydroxypropyl 2-(trimethylazaniumyl)ethyl phosphate (CAS 64681-08-9) is a chemical compound with the molecular formula C8H20CdCl2NO6P and a molecular weight of 440.54 g/mol. IUPAC name: dichlorocadmium;2,3-dihydroxypropyl 2-(trimethylazaniumyl)ethyl phosphate. InChIKey: RCOWLNSSDOITMP-UHFFFAOYSA-L.
| Molecular formula | C8H20CdCl2NO6P |
|---|---|
| Molecular weight | 440.54 g/mol |
| IUPAC name | dichlorocadmium;2,3-dihydroxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| InChIKey | RCOWLNSSDOITMP-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OCC(CO)O.Cl[Cd]Cl |
Computed by PubChem (NCBI)