CAS 64691-63-0 appears in our catalog under these names: Cypermethrin Impurity 16, Hydroxy-cypermethrin (Racemic Mixture) (1:1), Hydroxy-cypermethrin. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg.
[cyano-[3-(4-hydroxyphenoxy)phenyl]methyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (CAS 64691-63-0) is a chemical compound with the molecular formula C22H19Cl2NO4 and a molecular weight of 432.3 g/mol. IUPAC name: [cyano-[3-(4-hydroxyphenoxy)phenyl]methyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: RMCYSJORMXBLLG-UHFFFAOYSA-N.
| Molecular formula | C22H19Cl2NO4 |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | [cyano-[3-(4-hydroxyphenoxy)phenyl]methyl] 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | RMCYSJORMXBLLG-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=C(C=C3)O)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)