CAS 647-12-1 appears in our catalog under these names: Perfluorooctanonitrile, 95%, Perfluorooctanonitrile, 98%, Pentadecafluorooctanenitrile. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25g, 200mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanenitrile (CAS 647-12-1) is a chemical compound with the molecular formula C8F15N and a molecular weight of 395.07 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanenitrile. InChIKey: FULLNJNBFUCVES-UHFFFAOYSA-N.
| Molecular formula | C8F15N |
|---|---|
| Molecular weight | 395.07 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanenitrile |
| InChIKey | FULLNJNBFUCVES-UHFFFAOYSA-N |
| SMILES | C(#N)C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)