CAS 647026-57-1 is the registry number for (S)-1-(4-Iodophenyl)ethane-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(4-iodophenyl)ethane-1,2-diol (CAS 647026-57-1) is a chemical compound with the molecular formula C8H9IO2 and a molecular weight of 264.06 g/mol. IUPAC name: (1S)-1-(4-iodophenyl)ethane-1,2-diol. InChIKey: ZNNCSCNNQXKILF-MRVPVSSYSA-N.
| Molecular formula | C8H9IO2 |
|---|---|
| Molecular weight | 264.06 g/mol |
| IUPAC name | (1S)-1-(4-iodophenyl)ethane-1,2-diol |
| InChIKey | ZNNCSCNNQXKILF-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)O)I |
Computed by PubChem (NCBI)