CAS 6472-91-9 appears in our catalog under these names: Chrysamine G Disodium Salt, Chrysamine G, CHRYSAMINE G. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 5 mg, 10 mg.
Disodium;2-carboxy-4-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]phenyl]phenyl]diazenyl]phenolate (CAS 6472-91-9) is a chemical compound with the molecular formula C26H16N4Na2O6 and a molecular weight of 526.4 g/mol. IUPAC name: disodium;2-carboxy-4-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]phenyl]phenyl]diazenyl]phenolate. InChIKey: AZOPGDOIOXKJRA-UHFFFAOYSA-L.
| Molecular formula | C26H16N4Na2O6 |
|---|---|
| Molecular weight | 526.4 g/mol |
| IUPAC name | disodium;2-carboxy-4-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]phenyl]phenyl]diazenyl]phenolate |
| InChIKey | AZOPGDOIOXKJRA-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N=NC3=CC(=C(C=C3)[O-])C(=O)O)N=NC4=CC(=C(C=C4)[O-])C(=O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)