CAS 64736-49-8 appears in our catalog under these names: 4,5-Dichloro-2-(trifluoromethyl)imidazole, 95%, 4,5-Dichloro-2-(trifluoromethyl)imidazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,5-dichloro-2-(trifluoromethyl)-1H-imidazole (CAS 64736-49-8) is a chemical compound with the molecular formula C4HCl2F3N2 and a molecular weight of 204.96 g/mol. IUPAC name: 4,5-dichloro-2-(trifluoromethyl)-1H-imidazole. InChIKey: ILZVPHDSQNNZBX-UHFFFAOYSA-N.
| Molecular formula | C4HCl2F3N2 |
|---|---|
| Molecular weight | 204.96 g/mol |
| IUPAC name | 4,5-dichloro-2-(trifluoromethyl)-1H-imidazole |
| InChIKey | ILZVPHDSQNNZBX-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N1)C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)