CAS 64755-47-1 appears in our catalog under these names: Sodium 4-bromophenylmethanesulfonate, 98%, Sodium(4–bromophenyl)methanesulfonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 25g.
Sodium (4-bromophenyl)methanesulfonate (CAS 64755-47-1) is a chemical compound with the molecular formula C7H6BrNaO3S and a molecular weight of 273.08 g/mol. IUPAC name: sodium (4-bromophenyl)methanesulfonate. InChIKey: KSRAEFLKOUHQDU-UHFFFAOYSA-M.
| Molecular formula | C7H6BrNaO3S |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | sodium (4-bromophenyl)methanesulfonate |
| InChIKey | KSRAEFLKOUHQDU-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)[O-])Br.[Na+] |
Computed by PubChem (NCBI)