Products 64757-32-0

CAS 64757-32-0 is the registry number for 2-(Methylsulfanyl)-2-(thiophen-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-methylsulfanyl-2-thiophen-2-ylacetic acid (CAS 64757-32-0) is a chemical compound with the molecular formula C7H8O2S2 and a molecular weight of 188.3 g/mol. IUPAC name: 2-methylsulfanyl-2-thiophen-2-ylacetic acid. InChIKey: CLYKDQITNZFTRT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O2S2
Molecular weight188.3 g/mol
IUPAC name2-methylsulfanyl-2-thiophen-2-ylacetic acid
InChIKeyCLYKDQITNZFTRT-UHFFFAOYSA-N
SMILESCSC(C1=CC=CS1)C(=O)O

Computed by PubChem (NCBI)