Products 64768-38-3

CAS 64768-38-3 is the registry number for Ethyl 2-Bromo-2-methyl-d3-propionate-3,3,3-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

Ethyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate (CAS 64768-38-3) is a chemical compound with the molecular formula C6H11BrO2 and a molecular weight of 201.09 g/mol. IUPAC name: ethyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate. InChIKey: IOLQWGVDEFWYNP-XERRXZQWSA-N.

Identity
Molecular formulaC6H11BrO2
Molecular weight201.09 g/mol
IUPAC nameethyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate
InChIKeyIOLQWGVDEFWYNP-XERRXZQWSA-N
SMILES[2H]C([2H])([2H])C(C(=O)OCC)(C([2H])([2H])[2H])Br

Computed by PubChem (NCBI)