CAS 64768-38-3 is the registry number for Ethyl 2-Bromo-2-methyl-d3-propionate-3,3,3-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
Ethyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate (CAS 64768-38-3) is a chemical compound with the molecular formula C6H11BrO2 and a molecular weight of 201.09 g/mol. IUPAC name: ethyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate. InChIKey: IOLQWGVDEFWYNP-XERRXZQWSA-N.
| Molecular formula | C6H11BrO2 |
|---|---|
| Molecular weight | 201.09 g/mol |
| IUPAC name | ethyl 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoate |
| InChIKey | IOLQWGVDEFWYNP-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)OCC)(C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)