Products 647841-31-4
CAS 647841-31-4 is the registry number for 4,5-Dimethyl-1-(2,4,6-trimethylphenyl)-1H-imidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,5-dimethyl-1-(2,4,6-trimethylphenyl)imidazole (CAS 647841-31-4) is a chemical compound with the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. IUPAC name: 4,5-dimethyl-1-(2,4,6-trimethylphenyl)imidazole. InChIKey: FLNYCJUFOUHHBO-UHFFFAOYSA-N.
| Molecular formula | C14H18N2 |
|---|---|
| Molecular weight | 214.31 g/mol |
| IUPAC name | 4,5-dimethyl-1-(2,4,6-trimethylphenyl)imidazole |
| InChIKey | FLNYCJUFOUHHBO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=NC(=C2C)C)C |
Computed by PubChem (NCBI)