Products 64793-97-1
CAS 64793-97-1 is the registry number for 3-(3,5-Bis(Phenylmethoxy)phenyl)-2-propenoic Acid. Offered by: TRC. Available pack sizes: 1g.
(E)-3-[3,5-bis(phenylmethoxy)phenyl]prop-2-enoic acid (CAS 64793-97-1) is a chemical compound with the molecular formula C23H20O4 and a molecular weight of 360.4 g/mol. IUPAC name: (E)-3-[3,5-bis(phenylmethoxy)phenyl]prop-2-enoic acid. InChIKey: AJQPGVIYJNPOBK-VAWYXSNFSA-N.
| Molecular formula | C23H20O4 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | (E)-3-[3,5-bis(phenylmethoxy)phenyl]prop-2-enoic acid |
| InChIKey | AJQPGVIYJNPOBK-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)/C=C/C(=O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)