Products 64803-10-7
CAS 64803-10-7 is the registry number for TYT-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3Z)-3-(1,1-dioxo-2-phenyl-1,4,2-dithiazolidin-3-ylidene)-1,1-diphenylthiourea (CAS 64803-10-7) is a chemical compound with the molecular formula C21H17N3O2S3 and a molecular weight of 439.6 g/mol. IUPAC name: (3Z)-3-(1,1-dioxo-2-phenyl-1,4,2-dithiazolidin-3-ylidene)-1,1-diphenylthiourea. InChIKey: WHFLLSDSNHZKAX-DQRAZIAOSA-N.
| Molecular formula | C21H17N3O2S3 |
|---|---|
| Molecular weight | 439.6 g/mol |
| IUPAC name | (3Z)-3-(1,1-dioxo-2-phenyl-1,4,2-dithiazolidin-3-ylidene)-1,1-diphenylthiourea |
| InChIKey | WHFLLSDSNHZKAX-DQRAZIAOSA-N |
| SMILES | C1S/C(=N\C(=S)N(C2=CC=CC=C2)C3=CC=CC=C3)/N(S1(=O)=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)