CAS 64821-69-8 is the registry number for Trityl triflate. Offered by: Fluorochem. Available pack sizes: 1g.
Diphenylmethylbenzene;trifluoromethanesulfonate (CAS 64821-69-8) is a chemical compound with the molecular formula C20H15F3O3S and a molecular weight of 392.4 g/mol. IUPAC name: diphenylmethylbenzene;trifluoromethanesulfonate. InChIKey: IEZOKZHBOQDYGI-UHFFFAOYSA-M.
| Molecular formula | C20H15F3O3S |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | diphenylmethylbenzene;trifluoromethanesulfonate |
| InChIKey | IEZOKZHBOQDYGI-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[C+](C2=CC=CC=C2)C3=CC=CC=C3.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)