CAS 648409-35-2 is the registry number for 4-Chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzamide (CAS 648409-35-2) is a chemical compound with the molecular formula C13H11ClN4O3 and a molecular weight of 306.70 g/mol. IUPAC name: 4-chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzamide. InChIKey: WBFPNMVALSMJDY-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN4O3 |
|---|---|
| Molecular weight | 306.70 g/mol |
| IUPAC name | 4-chloro-N,N-bis(2-cyanoethyl)-3-nitrobenzamide |
| InChIKey | WBFPNMVALSMJDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N(CCC#N)CCC#N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)