CAS 6485-39-8 appears in our catalog under these names: Manganese gluconate, 95%, Manganese gluconate, D-Gluconic acid manganese salt, Gluconic acid manganese salt, 98.00%, Manganesegluconate 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 25g, 1kg, 500g, 100g, 5g, 250g, 1000g, 5000g.
Manganese(2+);bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) (CAS 6485-39-8) is a chemical compound with the molecular formula C12H22MnO14 and a molecular weight of 445.23 g/mol. IUPAC name: manganese(2+);bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate). InChIKey: OXHQNTSSPHKCPB-IYEMJOQQSA-L.
| Molecular formula | C12H22MnO14 |
|---|---|
| Molecular weight | 445.23 g/mol |
| IUPAC name | manganese(2+);bis((2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate) |
| InChIKey | OXHQNTSSPHKCPB-IYEMJOQQSA-L |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Mn+2] |
Computed by PubChem (NCBI)