CAS 6485-58-1 appears in our catalog under these names: 1–Iodoethane–1,1,2,2,2–d5, 1-Iodoethane-1,1,2,2,2-d5, 99.90%, 1-Iodoethane-1,1,2,2,2-d5, 98%, Iodoethane-d5, 95%, Iodoethane-d5 (stabilized with Copper wire), >95% (GC). Offered by: GLPBio, MedChemExpress, Fluorochem, Combi-blocks, TRC. Available pack sizes: 100mg, 500mg, 100 mg, 250 mg, 1 g, 5 g, 250mg, 1g.
1,1,1,2,2-pentadeuterio-2-iodoethane (CAS 6485-58-1) is a chemical compound with the molecular formula C2H5I and a molecular weight of 161.00 g/mol. IUPAC name: 1,1,1,2,2-pentadeuterio-2-iodoethane. InChIKey: HVTICUPFWKNHNG-ZBJDZAJPSA-N.
| Molecular formula | C2H5I |
|---|---|
| Molecular weight | 161.00 g/mol |
| IUPAC name | 1,1,1,2,2-pentadeuterio-2-iodoethane |
| InChIKey | HVTICUPFWKNHNG-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])I |
Computed by PubChem (NCBI)