CAS 6485-97-8 appears in our catalog under these names: 2-Phenylanthraquinone, 98%, 2–Phenylanthraquinone, 2-Phenylanthraquinone, >98.0%(GC), 2-Phenylanthracene-9,10-dione 98%, 2-phenyl-9,10-dihydroanthracene-9,10-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg.
2-phenylanthracene-9,10-dione (CAS 6485-97-8) is a chemical compound with the molecular formula C20H12O2 and a molecular weight of 284.3 g/mol. IUPAC name: 2-phenylanthracene-9,10-dione. InChIKey: NTZCFGZBDDCNHI-UHFFFAOYSA-N.
| Molecular formula | C20H12O2 |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 2-phenylanthracene-9,10-dione |
| InChIKey | NTZCFGZBDDCNHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)