CAS 64863-10-1 appears in our catalog under these names: 2-Amino-6-chloro-5-nitrotoluene, 98%, 3-Chloro-2-methyl-4-nitroaniline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g, 50mg, 100mg.
3-chloro-2-methyl-4-nitroaniline (CAS 64863-10-1) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 3-chloro-2-methyl-4-nitroaniline. InChIKey: AKXKBXITZBLAAQ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 3-chloro-2-methyl-4-nitroaniline |
| InChIKey | AKXKBXITZBLAAQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)