CAS 648860-66-6 is the registry number for 2-(2,4-dichlorophenoxy)-N-(((phenylcarbonylamino)thioxomethyl)amino)propanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]benzamide (CAS 648860-66-6) is a chemical compound with the molecular formula C17H15Cl2N3O3S and a molecular weight of 412.3 g/mol. IUPAC name: N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]benzamide. InChIKey: HTJHTGUCHYJAMG-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2N3O3S |
|---|---|
| Molecular weight | 412.3 g/mol |
| IUPAC name | N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]benzamide |
| InChIKey | HTJHTGUCHYJAMG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NNC(=S)NC(=O)C1=CC=CC=C1)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)