Products 648904-56-7
CAS 648904-56-7 is the registry number for LY2066948. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(4-methylsulfonylphenyl)-5-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-ol (CAS 648904-56-7) is a chemical compound with the molecular formula C30H31NO5S and a molecular weight of 517.6 g/mol. IUPAC name: 6-(4-methylsulfonylphenyl)-5-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-ol. InChIKey: NJVFOFMHUJJIMB-UHFFFAOYSA-N.
| Molecular formula | C30H31NO5S |
|---|---|
| Molecular weight | 517.6 g/mol |
| IUPAC name | 6-(4-methylsulfonylphenyl)-5-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-ol |
| InChIKey | NJVFOFMHUJJIMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=C(C3=C(C=C2)C=C(C=C3)O)OC4=CC=C(C=C4)OCCN5CCCCC5 |
Computed by PubChem (NCBI)