Products 64921-57-9
CAS 64921-57-9 is the registry number for N-(3,3-Dimethyl-1-(1H-pyrazol-1-yl)butan-2-ylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(NE)-N-(3,3-dimethyl-1-pyrazol-1-ylbutan-2-ylidene)hydroxylamine (CAS 64921-57-9) is a chemical compound with the molecular formula C9H15N3O and a molecular weight of 181.23 g/mol. IUPAC name: (NE)-N-(3,3-dimethyl-1-pyrazol-1-ylbutan-2-ylidene)hydroxylamine. InChIKey: BWXVWKXPUPYLTK-FLIBITNWSA-N.
| Molecular formula | C9H15N3O |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (NE)-N-(3,3-dimethyl-1-pyrazol-1-ylbutan-2-ylidene)hydroxylamine |
| InChIKey | BWXVWKXPUPYLTK-FLIBITNWSA-N |
| SMILES | CC(C)(C)/C(=N\O)/CN1C=CC=N1 |
Computed by PubChem (NCBI)