Products 64951-11-7
CAS 64951-11-7 appears in our catalog under these names: Imidazo[1,2-a]pyrimidine-3-carboxylic acid, 95%, Imidazo[1,2-a]pyrimidine-3-carboxylic acid, 97%, 97%, Imidazo[1,2-a]pyrimidine-3-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
Imidazo[1,2-a]pyrimidine-3-carboxylic acid (CAS 64951-11-7) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: imidazo[1,2-a]pyrimidine-3-carboxylic acid. InChIKey: HZXJBCVANGLSGC-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | imidazo[1,2-a]pyrimidine-3-carboxylic acid |
| InChIKey | HZXJBCVANGLSGC-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2N=C1)C(=O)O |
Computed by PubChem (NCBI)