CAS 649662-56-6 is the registry number for 4,5-Dichloro-1-(2-Nitro-4-(Trifluoromethyl)Phenyl)-1H-Imidazole. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
4,5-dichloro-1-[2-nitro-4-(trifluoromethyl)phenyl]imidazole (CAS 649662-56-6) is a chemical compound with the molecular formula C10H4Cl2F3N3O2 and a molecular weight of 326.06 g/mol. IUPAC name: 4,5-dichloro-1-[2-nitro-4-(trifluoromethyl)phenyl]imidazole. InChIKey: RGHMKNKYGNLLRK-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2F3N3O2 |
|---|---|
| Molecular weight | 326.06 g/mol |
| IUPAC name | 4,5-dichloro-1-[2-nitro-4-(trifluoromethyl)phenyl]imidazole |
| InChIKey | RGHMKNKYGNLLRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])N2C=NC(=C2Cl)Cl |
Computed by PubChem (NCBI)