CAS 6497-03-6 appears in our catalog under these names: Methyl 2-amino-4-(2-methoxy-2-oxoethyl)thiazole-5-carboxylate hydrochloride, 97%, Methyl 2-amino-4-(2-methoxy-2-oxoethyl)thiazole-5-carboxylate hydrochloride, 97.0%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
Methyl 2-amino-4-(2-methoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate;hydrochloride (CAS 6497-03-6) is a chemical compound with the molecular formula C8H11ClN2O4S and a molecular weight of 266.70 g/mol. IUPAC name: methyl 2-amino-4-(2-methoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate;hydrochloride. InChIKey: ZONFFTSIUQUDSI-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O4S |
|---|---|
| Molecular weight | 266.70 g/mol |
| IUPAC name | methyl 2-amino-4-(2-methoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate;hydrochloride |
| InChIKey | ZONFFTSIUQUDSI-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(SC(=N1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)