Products 64977-24-8

CAS 64977-24-8 is the registry number for Chlorambucil Ethyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (CAS 64977-24-8) is a chemical compound with the molecular formula C16H23Cl2NO2 and a molecular weight of 332.3 g/mol. IUPAC name: ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate. InChIKey: XHMWSXLDNNNEPC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23Cl2NO2
Molecular weight332.3 g/mol
IUPAC nameethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate
InChIKeyXHMWSXLDNNNEPC-UHFFFAOYSA-N
SMILESCCOC(=O)CCCC1=CC=C(C=C1)N(CCCl)CCCl

Computed by PubChem (NCBI)