CAS 65-28-1 appears in our catalog under these names: Phentolamine Mesylate, Phentolamine Methanesulfonate Salt, >95% (HPLC), Phentolamine Mesilate, Phentolamine mesylate/ 99.9%, Phentolamine Mesylate. Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 100mg, 250mg, 10mg, 200mg, 500mg, 10mM (in 1ml dmso), 1g.
3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol;methanesulfonic acid (CAS 65-28-1) is a chemical compound with the molecular formula C18H23N3O4S and a molecular weight of 377.5 g/mol. IUPAC name: 3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol;methanesulfonic acid. InChIKey: OGIYDFVHFQEFKQ-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O4S |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol;methanesulfonic acid |
| InChIKey | OGIYDFVHFQEFKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(CC2=NCCN2)C3=CC(=CC=C3)O.CS(=O)(=O)O |
Computed by PubChem (NCBI)