CAS 65-31-6 appears in our catalog under these names: (-)-Nicotine Ditartrate, (-)-Nicotine Ditartrate, >95% (HPLC), Nicotine ditartrate, Nicotine Difartrate, (-)-Nicotine hydrogen tartrate salt, 98.50%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, Chemat. Available pack sizes: on request, 100mg, 1g, 5g, 10mM (in 1ml dmso), 50mg, 0,5g, 0,25g.
Bis((2R,3R)-2,3-dihydroxybutanedioic acid);3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 65-31-6) is a chemical compound with the molecular formula C18H26N2O12 and a molecular weight of 462.4 g/mol. IUPAC name: bis((2R,3R)-2,3-dihydroxybutanedioic acid);3-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: RFEJUZJILGIRHQ-OMDKHLBYSA-N.
| Molecular formula | C18H26N2O12 |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | bis((2R,3R)-2,3-dihydroxybutanedioic acid);3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | RFEJUZJILGIRHQ-OMDKHLBYSA-N |
| SMILES | CN1CCC[C@H]1C2=CN=CC=C2.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)