CAS 65-61-2 appears in our catalog under these names: ACRIDINE ORANGE SOLUTION, 2% IN H2O, Acridine orange hydrochloride, 95%, Acridine Orange hydrochloride/ 98.27% (existing batch purity), Acridine Orange hydrochloride, Acridine orange hydrochloride hydrate. Offered by: Sigma-Aldrich, Combi-blocks, TargetMol, GLPBio, Biosynth. Available pack sizes: 10ML, 5g, 1g, 100mg, 50mg, 2,5g, 0,25g, 5ml.
3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine;hydrochloride (CAS 65-61-2) is a chemical compound with the molecular formula C17H20ClN3 and a molecular weight of 301.8 g/mol. IUPAC name: 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine;hydrochloride. InChIKey: VSTHNGLPHBTRMB-UHFFFAOYSA-N.
| Molecular formula | C17H20ClN3 |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine;hydrochloride |
| InChIKey | VSTHNGLPHBTRMB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C3C=CC(=CC3=N2)N(C)C.Cl |
Computed by PubChem (NCBI)