CAS 65019-14-9 is the registry number for Nifuratel Impurity 24 (nitrofurfural). Offered by: Chemat Brand. Available pack sizes: on request.
3-nitrofuran-2-carbaldehyde (CAS 65019-14-9) is a chemical compound with the molecular formula C5H3NO4 and a molecular weight of 141.08 g/mol. IUPAC name: 3-nitrofuran-2-carbaldehyde. InChIKey: XPEJRQSXLRKGBZ-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4 |
|---|---|
| Molecular weight | 141.08 g/mol |
| IUPAC name | 3-nitrofuran-2-carbaldehyde |
| InChIKey | XPEJRQSXLRKGBZ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)