CAS 65022-15-3 appears in our catalog under these names: Z–Gly–Pro–pNA, Z-Gly-Pro-pNA, Z-Gly-Pro-pNA 95%, Z-GLY-PRO-4-NITROANILIDE >= 99.0% (&, Z-Gly-Pro-pNA, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 0,25g, 100mg, 500MG, 50mg, 100 mg, 10mM/1mL.
Benzyl N-[2-[(2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate (CAS 65022-15-3) is a chemical compound with the molecular formula C21H22N4O6 and a molecular weight of 426.4 g/mol. IUPAC name: benzyl N-[2-[(2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate. InChIKey: UTXSFKPOIVELPQ-SFHVURJKSA-N.
| Molecular formula | C21H22N4O6 |
|---|---|
| Molecular weight | 426.4 g/mol |
| IUPAC name | benzyl N-[2-[(2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| InChIKey | UTXSFKPOIVELPQ-SFHVURJKSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CNC(=O)OCC2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)