Products 65032-48-6
CAS 65032-48-6 is the registry number for N-cyclopentyl-4-methylbenzenesulfonamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N-cyclopentyl-4-methylbenzenesulfonamide (CAS 65032-48-6) is a chemical compound with the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. IUPAC name: N-cyclopentyl-4-methylbenzenesulfonamide. InChIKey: GXUUMIXUNMJARY-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2S |
|---|---|
| Molecular weight | 239.34 g/mol |
| IUPAC name | N-cyclopentyl-4-methylbenzenesulfonamide |
| InChIKey | GXUUMIXUNMJARY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2CCCC2 |
Computed by PubChem (NCBI)