Products 65039-06-7

CAS 65039-06-7 is the registry number for 3-Methyl-1-phenyl-1H-imidazol-3-ium iodide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-methyl-3-phenylimidazol-1-ium iodide (CAS 65039-06-7) is a chemical compound with the molecular formula C10H11IN2 and a molecular weight of 286.11 g/mol. IUPAC name: 1-methyl-3-phenylimidazol-1-ium iodide. InChIKey: FPFAVRAWWGOLSN-UHFFFAOYSA-M.

Identity
Molecular formulaC10H11IN2
Molecular weight286.11 g/mol
IUPAC name1-methyl-3-phenylimidazol-1-ium iodide
InChIKeyFPFAVRAWWGOLSN-UHFFFAOYSA-M
SMILESC[N+]1=CN(C=C1)C2=CC=CC=C2.[I-]

Computed by PubChem (NCBI)