Products 65039-10-3

CAS 65039-10-3 appears in our catalog under these names: 1-Allyl-3-methyl-3-imidazolium chloride 98%, 1-Allyl-3-methyl-3-imidazolium chloride, 98%, 1–Allyl–3–methylimidazolium chloride, 1-ALLYL-3-METHYLIMIDAZOLIUM CHLORIDE, >&, 1-ALLYL-3-METHYLIMIDAZOLIUM CHLORIDE, >=. Offered by: Ambeed, Fluorochem, GLPBio, Sigma-Aldrich, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 25g, 100g, 500g, 1000g, 1kg, 50g.

Structural formula: {0} (CAS {1})

1-methyl-3-prop-2-enylimidazol-1-ium chloride (CAS 65039-10-3) is a chemical compound with the molecular formula C7H11ClN2 and a molecular weight of 158.63 g/mol. IUPAC name: 1-methyl-3-prop-2-enylimidazol-1-ium chloride. InChIKey: QVRCRKLLQYOIKY-UHFFFAOYSA-M.

Identity
Molecular formulaC7H11ClN2
Molecular weight158.63 g/mol
IUPAC name1-methyl-3-prop-2-enylimidazol-1-ium chloride
InChIKeyQVRCRKLLQYOIKY-UHFFFAOYSA-M
SMILESC[N+]1=CN(C=C1)CC=C.[Cl-]

Computed by PubChem (NCBI)