CAS 650592-08-8 is the registry number for 2-(4,5-Dichloro-1H-imidazol-1-yl)-5-(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
2-(4,5-dichloroimidazol-1-yl)-5-(trifluoromethyl)pyridine (CAS 650592-08-8) is a chemical compound with the molecular formula C9H4Cl2F3N3 and a molecular weight of 282.05 g/mol. IUPAC name: 2-(4,5-dichloroimidazol-1-yl)-5-(trifluoromethyl)pyridine. InChIKey: WQGJPMYNOAHQPU-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2F3N3 |
|---|---|
| Molecular weight | 282.05 g/mol |
| IUPAC name | 2-(4,5-dichloroimidazol-1-yl)-5-(trifluoromethyl)pyridine |
| InChIKey | WQGJPMYNOAHQPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(F)(F)F)N2C=NC(=C2Cl)Cl |
Computed by PubChem (NCBI)