CAS 650592-36-2 appears in our catalog under these names: (4,5-Dichloro-1h-imidazol-1-yl)methyl n-(4-chlorophenyl)carbamate, 95%, (4,5-Dichloro-1H-imidazol-1-yl)methyl (4-chlorophenyl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(4,5-dichloroimidazol-1-yl)methyl N-(4-chlorophenyl)carbamate (CAS 650592-36-2) is a chemical compound with the molecular formula C11H8Cl3N3O2 and a molecular weight of 320.6 g/mol. IUPAC name: (4,5-dichloroimidazol-1-yl)methyl N-(4-chlorophenyl)carbamate. InChIKey: MQTXCVWPPGAXTJ-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl3N3O2 |
|---|---|
| Molecular weight | 320.6 g/mol |
| IUPAC name | (4,5-dichloroimidazol-1-yl)methyl N-(4-chlorophenyl)carbamate |
| InChIKey | MQTXCVWPPGAXTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)OCN2C=NC(=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)