CAS 65061-19-0 appears in our catalog under these names: Vitamin K2 Impurity 1, cis-Vitamin K2, Phytomenadione Impurity 59. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
2-methyl-3-[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene-1,4-dione (CAS 65061-19-0) is a chemical compound with the molecular formula C31H40O2 and a molecular weight of 444.6 g/mol. IUPAC name: 2-methyl-3-[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene-1,4-dione. InChIKey: DKHGMERMDICWDU-IFQAVNAMSA-N.
| Molecular formula | C31H40O2 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | 2-methyl-3-[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene-1,4-dione |
| InChIKey | DKHGMERMDICWDU-IFQAVNAMSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(/C)\CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
Computed by PubChem (NCBI)