Products 650621-20-8
CAS 650621-20-8 is the registry number for PTP1B-IN-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-phenylpropanamide (CAS 650621-20-8) is a chemical compound with the molecular formula C24H25N3O3S2 and a molecular weight of 467.6 g/mol. IUPAC name: N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-phenylpropanamide. InChIKey: ZNWJPVHKYGKNLY-UHFFFAOYSA-N.
| Molecular formula | C24H25N3O3S2 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-phenylpropanamide |
| InChIKey | ZNWJPVHKYGKNLY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)NC(=S)NC(=O)CCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)