Products 65085-69-0
CAS 65085-69-0 appears in our catalog under these names: ent-Prostaglandin E2, ent–Prostaglandin E2. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 100ug, 500ug, 10mg, 5mg, 500 μg, 100 μg.
(Z)-7-[(1S,2S,3S)-3-hydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (CAS 65085-69-0) is a chemical compound with the molecular formula C20H32O5 and a molecular weight of 352.5 g/mol. IUPAC name: (Z)-7-[(1S,2S,3S)-3-hydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid. InChIKey: XEYBRNLFEZDVAW-OBUVHCMGSA-N.
| Molecular formula | C20H32O5 |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | (Z)-7-[(1S,2S,3S)-3-hydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| InChIKey | XEYBRNLFEZDVAW-OBUVHCMGSA-N |
| SMILES | CCCCC[C@H](/C=C/[C@@H]1[C@H](CC(=O)[C@H]1C/C=C\CCCC(=O)O)O)O |
Computed by PubChem (NCBI)