Products 65087-58-3
CAS 65087-58-3 appears in our catalog under these names: n-Propyl-d7-benzene, 98 atom % D, min 98% Chemical Purity, N-Propyl-d7-benzene. Offered by: CDN, Biosynth. Available pack sizes: 0,25g, 0,1g, 100mg, 50mg.
1,1,2,2,3,3,3-heptadeuteriopropylbenzene (CAS 65087-58-3) is a chemical compound with the molecular formula C9H12 and a molecular weight of 127.23 g/mol. IUPAC name: 1,1,2,2,3,3,3-heptadeuteriopropylbenzene. InChIKey: ODLMAHJVESYWTB-WDPWIZPISA-N.
| Molecular formula | C9H12 |
|---|---|
| Molecular weight | 127.23 g/mol |
| IUPAC name | 1,1,2,2,3,3,3-heptadeuteriopropylbenzene |
| InChIKey | ODLMAHJVESYWTB-WDPWIZPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC=CC=C1 |
Computed by PubChem (NCBI)