Products 65087-59-4

CAS 65087-59-4 is the registry number for n-Butyl-d9-benzene, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,1,2,2,3,3,4,4,4-nonadeuteriobutylbenzene (CAS 65087-59-4) is a chemical compound with the molecular formula C10H14 and a molecular weight of 143.27 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4-nonadeuteriobutylbenzene. InChIKey: OCKPCBLVNKHBMX-AZOWHCDPSA-N.

Identity
Molecular formulaC10H14
Molecular weight143.27 g/mol
IUPAC name1,1,2,2,3,3,4,4,4-nonadeuteriobutylbenzene
InChIKeyOCKPCBLVNKHBMX-AZOWHCDPSA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC=CC=C1

Computed by PubChem (NCBI)