CAS 651-89-8 is the registry number for 1,2,4,5-Tetrafluoro-3,6-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,2,4,5-tetrafluoro-3,6-bis(trifluoromethyl)benzene (CAS 651-89-8) is a chemical compound with the molecular formula C8F10 and a molecular weight of 286.07 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3,6-bis(trifluoromethyl)benzene. InChIKey: WWZNHODBHBVRID-UHFFFAOYSA-N.
| Molecular formula | C8F10 |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3,6-bis(trifluoromethyl)benzene |
| InChIKey | WWZNHODBHBVRID-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)C(F)(F)F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)