CAS 651056-84-7 appears in our catalog under these names: (S)-3-Amino-1-methylsulfonylpyrrolidine hydrochloride, 95%, (S)-1-(Methylsulfonyl)pyrrolidin-3-amine hydrochloride, 97%, (S)-1-(Methylsulfonyl)pyrrolidin-3-amine hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 100mg, 500mg, 50g.
(3S)-1-methylsulfonylpyrrolidin-3-amine;hydrochloride (CAS 651056-84-7) is a chemical compound with the molecular formula C5H13ClN2O2S and a molecular weight of 200.69 g/mol. IUPAC name: (3S)-1-methylsulfonylpyrrolidin-3-amine;hydrochloride. InChIKey: FNZSDPRWSRHDQD-JEDNCBNOSA-N.
| Molecular formula | C5H13ClN2O2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | (3S)-1-methylsulfonylpyrrolidin-3-amine;hydrochloride |
| InChIKey | FNZSDPRWSRHDQD-JEDNCBNOSA-N |
| SMILES | CS(=O)(=O)N1CC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)