CAS 65113-67-9 appears in our catalog under these names: Glutamyl-Glycyl-Arginine Chloromethyl Ketone, H-Glu-Gly-Arg-chloromethylketone trifluoroacetate salt, GGACK, H–Glu–Gly–Arg–chloromethylketone, GGACK 1PC x 5MG. Offered by: Chemat Brand, Creative Peptides, TRC, GLPBio, Biosynth. Available pack sizes: on request, 75mg, 25mg, 5mg, 0,25g, 0,5g, 1g, 10 mg.
(4S)-4-amino-5-[[2-[[(3S)-1-chloro-6-(diaminomethylideneamino)-2-oxohexan-3-yl]amino]acetyl]amino]-5-oxopentanoic acid (CAS 65113-67-9) is a chemical compound with the molecular formula C14H25ClN6O5 and a molecular weight of 392.84 g/mol. IUPAC name: (4S)-4-amino-5-[[2-[[(3S)-1-chloro-6-(diaminomethylideneamino)-2-oxohexan-3-yl]amino]acetyl]amino]-5-oxopentanoic acid. InChIKey: XBPBJFWGYUJISD-IUCAKERBSA-N.
| Molecular formula | C14H25ClN6O5 |
|---|---|
| Molecular weight | 392.84 g/mol |
| IUPAC name | (4S)-4-amino-5-[[2-[[(3S)-1-chloro-6-(diaminomethylideneamino)-2-oxohexan-3-yl]amino]acetyl]amino]-5-oxopentanoic acid |
| InChIKey | XBPBJFWGYUJISD-IUCAKERBSA-N |
| SMILES | C(C[C@@H](C(=O)CCl)NCC(=O)NC(=O)[C@H](CCC(=O)O)N)CN=C(N)N |
Computed by PubChem (NCBI)