CAS 651324-05-9 appears in our catalog under these names: Oseltamivir Impurity 122, Oseltamivir Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,5R,6S)-7-tert-butyl-5-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 651324-05-9) is a chemical compound with the molecular formula C18H31NO3 and a molecular weight of 309.4 g/mol. IUPAC name: ethyl (1R,5R,6S)-7-tert-butyl-5-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: UXYQFYXXRVMJMV-GNOXNVMVSA-N.
| Molecular formula | C18H31NO3 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | ethyl (1R,5R,6S)-7-tert-butyl-5-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | UXYQFYXXRVMJMV-GNOXNVMVSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]2[C@@H]1N2C(C)(C)C)C(=O)OCC |
Computed by PubChem (NCBI)