CAS 651326-78-2 is the registry number for 4,5-Difluoro-1,3-dihydro-2,1-benzoxaborol-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4,5-difluoro-1-hydroxy-3H-2,1-benzoxaborole (CAS 651326-78-2) is a chemical compound with the molecular formula C7H5BF2O2 and a molecular weight of 169.92 g/mol. IUPAC name: 4,5-difluoro-1-hydroxy-3H-2,1-benzoxaborole. InChIKey: KMDODYHDNAZJNN-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O2 |
|---|---|
| Molecular weight | 169.92 g/mol |
| IUPAC name | 4,5-difluoro-1-hydroxy-3H-2,1-benzoxaborole |
| InChIKey | KMDODYHDNAZJNN-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C(=C(C=C2)F)F)O |
Computed by PubChem (NCBI)