Products 65151-60-2

CAS 65151-60-2 is the registry number for Bis(3,5-dimethylphenyl) disulfide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-[(3,5-dimethylphenyl)disulfanyl]-3,5-dimethylbenzene (CAS 65151-60-2) is a chemical compound with the molecular formula C16H18S2 and a molecular weight of 274.4 g/mol. IUPAC name: 1-[(3,5-dimethylphenyl)disulfanyl]-3,5-dimethylbenzene. InChIKey: IRDMKAMOSXNGFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18S2
Molecular weight274.4 g/mol
IUPAC name1-[(3,5-dimethylphenyl)disulfanyl]-3,5-dimethylbenzene
InChIKeyIRDMKAMOSXNGFZ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)SSC2=CC(=CC(=C2)C)C)C

Computed by PubChem (NCBI)