Products 65169-35-9
CAS 65169-35-9 appears in our catalog under these names: Pyridine, 2-chloro-3,4-dimethyl-5-nitro-, 97%, 97%, 2-Chloro-3,4-dimethyl-5-nitropyridine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
2-chloro-3,4-dimethyl-5-nitropyridine (CAS 65169-35-9) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-3,4-dimethyl-5-nitropyridine. InChIKey: DPVSXUVKMQURNQ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-3,4-dimethyl-5-nitropyridine |
| InChIKey | DPVSXUVKMQURNQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1[N+](=O)[O-])Cl)C |
Computed by PubChem (NCBI)