CAS 65169-63-3 appears in our catalog under these names: 3-Methyl-5-nitropicolinonitrile 98%, 2–Cyano–3–Methyl–5–Nitropyridine, 3-Methyl-5-nitropicolinonitrile, 98%, 98%. Offered by: Ambeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3-methyl-5-nitropyridine-2-carbonitrile (CAS 65169-63-3) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-methyl-5-nitropyridine-2-carbonitrile. InChIKey: KMSQJNWARXZFII-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-methyl-5-nitropyridine-2-carbonitrile |
| InChIKey | KMSQJNWARXZFII-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)