Products 651750-08-2
CAS 651750-08-2 is the registry number for 8-(1,1-Dimethylallyl)genistein. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(2-methylbut-3-en-2-yl)chromen-4-one (CAS 651750-08-2) is a chemical compound with the molecular formula C20H18O5 and a molecular weight of 338.4 g/mol. IUPAC name: 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(2-methylbut-3-en-2-yl)chromen-4-one. InChIKey: PONIGBFVAFAGSR-UHFFFAOYSA-N.
| Molecular formula | C20H18O5 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(2-methylbut-3-en-2-yl)chromen-4-one |
| InChIKey | PONIGBFVAFAGSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C=C)C1=C(C=C(C2=C1OC=C(C2=O)C3=CC=C(C=C3)O)O)O |
Computed by PubChem (NCBI)